About (3E)-N,N-dimethylhexa-3,5-dien-3-amine
(3E)-N,N-dimethylhexa-3,5-dien-3-amine (PubChem CID 13112058) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is (3E)-N,N-dimethylhexa-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-N,N-dimethylhexa-3,5-dien-3-amine |
| PubChem CID | 13112058 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (3E)-N,N-dimethylhexa-3,5-dien-3-amine |
| SMILES | C=C/C=C(\CC)N(C)C |
| InChI | InChI=1S/C8H15N/c1-5-7-8(6-2)9(3)4/h5,7H,1,6H2,2-4H3/b8-7+ |
| InChIKey | GMRWMFIWTPVVHT-BQYQJAHWSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N,N-dimethylhexa-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N,N-dimethylhexa-3,5-dien-3-amine?
The IUPAC name of (3E)-N,N-dimethylhexa-3,5-dien-3-amine (CID 13112058) is (3E)-N,N-dimethylhexa-3,5-dien-3-amine.
What is the SMILES notation for (3E)-N,N-dimethylhexa-3,5-dien-3-amine?
The canonical SMILES for (3E)-N,N-dimethylhexa-3,5-dien-3-amine is C=C/C=C(\CC)N(C)C.
What is the InChIKey of (3E)-N,N-dimethylhexa-3,5-dien-3-amine?
The InChIKey is GMRWMFIWTPVVHT-BQYQJAHWSA-N. The full InChI is InChI=1S/C8H15N/c1-5-7-8(6-2)9(3)4/h5,7H,1,6H2,2-4H3/b8-7+.
What are the key properties of (3E)-N,N-dimethylhexa-3,5-dien-3-amine?
(3E)-N,N-dimethylhexa-3,5-dien-3-amine has a molecular weight of 125.21 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N,N-dimethylhexa-3,5-dien-3-amine is sourced from PubChem (CID 13112058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).