About tricyclo[3.3.0.02,7]octane
tricyclo[3.3.0.02,7]octane (PubChem CID 13112141) has the molecular formula C8H12
and a molecular weight of 108.18 g/mol. Its IUPAC name is tricyclo[3.3.0.02,7]octane.
Molecular Properties
| Compound Name | tricyclo[3.3.0.02,7]octane |
| PubChem CID | 13112141 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | tricyclo[3.3.0.02,7]octane |
| SMILES | C1CC2C3CC1C2C3 |
| InChI | InChI=1S/C8H12/c1-2-7-6-3-5(1)8(7)4-6/h5-8H,1-4H2 |
| InChIKey | FWABQYHXBQPJEP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tricyclo[3.3.0.02,7]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[3.3.0.02,7]octane?
The IUPAC name of tricyclo[3.3.0.02,7]octane (CID 13112141) is tricyclo[3.3.0.02,7]octane.
What is the SMILES notation for tricyclo[3.3.0.02,7]octane?
The canonical SMILES for tricyclo[3.3.0.02,7]octane is C1CC2C3CC1C2C3.
What is the InChIKey of tricyclo[3.3.0.02,7]octane?
The InChIKey is FWABQYHXBQPJEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12/c1-2-7-6-3-5(1)8(7)4-6/h5-8H,1-4H2.
What are the key properties of tricyclo[3.3.0.02,7]octane?
tricyclo[3.3.0.02,7]octane has a molecular weight of 108.18 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[3.3.0.02,7]octane is sourced from PubChem (CID 13112141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).