5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid

C6H8N2O4 — CID 131122642

IUPAC5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid
SMILESCN(O)Cc1cc(C(=O)O)no1
InChIInChI=1S/C6H8N2O4/c1-8(11)3-4-2-5(6(9)10)7-12-4/h2,11H,3H2,1H3,(H,9,10)
InChIKeyOHLCQYOVFUCDOP-UHFFFAOYSA-N
MW172.14 g/mol
LogP0.19
Rot. Bonds3

About 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid

5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 131122642) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid
PubChem CID131122642
Molecular FormulaC6H8N2O4
Molecular Weight172.14 g/mol
Exact Mass172.05
IUPAC Name5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid
SMILESCN(O)Cc1cc(C(=O)O)no1
InChIInChI=1S/C6H8N2O4/c1-8(11)3-4-2-5(6(9)10)7-12-4/h2,11H,3H2,1H3,(H,9,10)
InChIKeyOHLCQYOVFUCDOP-UHFFFAOYSA-N
XLogP0.19
TPSA86.80 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.14
LogP ≤ 50.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid (CID 131122642) is 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid is CN(O)Cc1cc(C(=O)O)no1.
What is the InChIKey of 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid?
The InChIKey is OHLCQYOVFUCDOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O4/c1-8(11)3-4-2-5(6(9)10)7-12-4/h2,11H,3H2,1H3,(H,9,10).
What are the key properties of 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid?
5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid has a molecular weight of 172.14 g/mol, XLogP of 0.19, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 131122642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).