C6H8N2O4 — CID 131122642
5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 131122642) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 131122642 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 5-[[hydroxy(methyl)amino]methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | CN(O)Cc1cc(C(=O)O)no1 |
| InChI | InChI=1S/C6H8N2O4/c1-8(11)3-4-2-5(6(9)10)7-12-4/h2,11H,3H2,1H3,(H,9,10) |
| InChIKey | OHLCQYOVFUCDOP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|