About (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid
(3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid (PubChem CID 131123038) has the molecular formula C9H8INO3
and a molecular weight of 305.07 g/mol. Its IUPAC name is (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| PubChem CID | 131123038 |
| Molecular Formula | C9H8INO3 |
| Molecular Weight | 305.07 g/mol |
| Exact Mass | 304.95 |
| IUPAC Name | (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| SMILES | N[C@@H]1COc2c(C(=O)O)ccc(I)c21 |
| InChI | InChI=1S/C9H8INO3/c10-5-2-1-4(9(12)13)8-7(5)6(11)3-14-8/h1-2,6H,3,11H2,(H,12,13)/t6-/m1/s1 |
| InChIKey | YBJIWRDXWRNHIB-ZCFIWIBFSA-N |
| XLogP | 1.38 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.07 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid?
The IUPAC name of (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid (CID 131123038) is (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid.
What is the SMILES notation for (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid?
The canonical SMILES for (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid is N[C@@H]1COc2c(C(=O)O)ccc(I)c21.
What is the InChIKey of (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid?
The InChIKey is YBJIWRDXWRNHIB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H8INO3/c10-5-2-1-4(9(12)13)8-7(5)6(11)3-14-8/h1-2,6H,3,11H2,(H,12,13)/t6-/m1/s1.
What are the key properties of (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid?
(3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid has a molecular weight of 305.07 g/mol, XLogP of 1.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-4-iodo-2,3-dihydro-1-benzofuran-7-carboxylic acid is sourced from PubChem (CID 131123038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).