About 2-N,6-N-diphenylpyridine-2,6-diamine
2-N,6-N-diphenylpyridine-2,6-diamine (PubChem CID 1311254) has the molecular formula C17H15N3
and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-N,6-N-diphenylpyridine-2,6-diamine.
Molecular Properties
| Compound Name | 2-N,6-N-diphenylpyridine-2,6-diamine |
| PubChem CID | 1311254 |
| Molecular Formula | C17H15N3 |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-N,6-N-diphenylpyridine-2,6-diamine |
| SMILES | c1ccc(Nc2cccc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H15N3/c1-3-8-14(9-4-1)18-16-12-7-13-17(20-16)19-15-10-5-2-6-11-15/h1-13H,(H2,18,19,20) |
| InChIKey | VTANJBBCJPIRSD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,6-N-diphenylpyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-diphenylpyridine-2,6-diamine?
The IUPAC name of 2-N,6-N-diphenylpyridine-2,6-diamine (CID 1311254) is 2-N,6-N-diphenylpyridine-2,6-diamine.
What is the SMILES notation for 2-N,6-N-diphenylpyridine-2,6-diamine?
The canonical SMILES for 2-N,6-N-diphenylpyridine-2,6-diamine is c1ccc(Nc2cccc(Nc3ccccc3)n2)cc1.
What is the InChIKey of 2-N,6-N-diphenylpyridine-2,6-diamine?
The InChIKey is VTANJBBCJPIRSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3/c1-3-8-14(9-4-1)18-16-12-7-13-17(20-16)19-15-10-5-2-6-11-15/h1-13H,(H2,18,19,20).
What are the key properties of 2-N,6-N-diphenylpyridine-2,6-diamine?
2-N,6-N-diphenylpyridine-2,6-diamine has a molecular weight of 261.33 g/mol, XLogP of 4.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-diphenylpyridine-2,6-diamine is sourced from PubChem (CID 1311254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).