C19H18N8O8 — CID 13112668
(2,4-dinitrophenyl)-[2-(2,4-dinitrophenyl)-3,4,4,5-tetramethylpyrazol-3-yl]diazene (PubChem CID 13112668) has the molecular formula C19H18N8O8 and a molecular weight of 486.40 g/mol. Its IUPAC name is (2,4-dinitrophenyl)-[2-(2,4-dinitrophenyl)-3,4,4,5-tetramethylpyrazol-3-yl]diazene.
| Compound Name | (2,4-dinitrophenyl)-[2-(2,4-dinitrophenyl)-3,4,4,5-tetramethylpyrazol-3-yl]diazene |
|---|---|
| PubChem CID | 13112668 |
| Molecular Formula | C19H18N8O8 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (2,4-dinitrophenyl)-[2-(2,4-dinitrophenyl)-3,4,4,5-tetramethylpyrazol-3-yl]diazene |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(C)(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1(C)C |
| InChI | InChI=1S/C19H18N8O8/c1-11-18(2,3)19(4,22-20-14-7-5-12(24(28)29)9-16(14)26(32)33)23(21-11)15-8-6-13(25(30)31)10-17(15)27(34)35/h5-10H,1-4H3/b22-20+ |
| InChIKey | SWPCHTWQHUWULZ-LSDHQDQOSA-N |
| XLogP | 5.04 |
| TPSA | 212.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|