C13H16N4O — CID 13112728
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethylphenol (PubChem CID 13112728) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethylphenol.
| Compound Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 13112728 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(Cc2cnc(N)nc2N)cc(C)c1O |
| InChI | InChI=1S/C13H16N4O/c1-7-3-9(4-8(2)11(7)18)5-10-6-16-13(15)17-12(10)14/h3-4,6,18H,5H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | JWSXYKJRCWICKV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |