About 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol
2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol (PubChem CID 13112732) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol.
Molecular Properties
| Compound Name | 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol |
| PubChem CID | 13112732 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol |
| SMILES | Cc1cc(Cc2cnc(N)nc2N)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C16H22N4O/c1-9-5-10(7-12(13(9)21)16(2,3)4)6-11-8-19-15(18)20-14(11)17/h5,7-8,21H,6H2,1-4H3,(H4,17,18,19,20) |
| InChIKey | CNXOYJDOJBIVDI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol?
The IUPAC name of 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol (CID 13112732) is 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol.
What is the SMILES notation for 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol?
The canonical SMILES for 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol is Cc1cc(Cc2cnc(N)nc2N)cc(C(C)(C)C)c1O.
What is the InChIKey of 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol?
The InChIKey is CNXOYJDOJBIVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O/c1-9-5-10(7-12(13(9)21)16(2,3)4)6-11-8-19-15(18)20-14(11)17/h5,7-8,21H,6H2,1-4H3,(H4,17,18,19,20).
What are the key properties of 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol?
2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol has a molecular weight of 286.38 g/mol, XLogP of 2.54, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-[(2,4-diaminopyrimidin-5-yl)methyl]-6-methylphenol is sourced from PubChem (CID 13112732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).