C17H24N4O — CID 13112738
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dipropylphenol (PubChem CID 13112738) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dipropylphenol.
| Compound Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dipropylphenol |
|---|---|
| PubChem CID | 13112738 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dipropylphenol |
| SMILES | CCCc1cc(Cc2cnc(N)nc2N)cc(CCC)c1O |
| InChI | InChI=1S/C17H24N4O/c1-3-5-12-7-11(8-13(6-4-2)15(12)22)9-14-10-20-17(19)21-16(14)18/h7-8,10,22H,3-6,9H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | WDRBPLXHBTYNRP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |