About 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol (PubChem CID 13112740) has the molecular formula C17H24N4O
and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol.
Molecular Properties
| Compound Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol |
| PubChem CID | 13112740 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(Cc2cnc(N)nc2N)cc(C(C)C)c1O |
| InChI | InChI=1S/C17H24N4O/c1-9(2)13-6-11(7-14(10(3)4)15(13)22)5-12-8-20-17(19)21-16(12)18/h6-10,22H,5H2,1-4H3,(H4,18,19,20,21) |
| InChIKey | YZDAHKBHIGEAAB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol?
The IUPAC name of 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol (CID 13112740) is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol.
What is the SMILES notation for 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol?
The canonical SMILES for 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol is CC(C)c1cc(Cc2cnc(N)nc2N)cc(C(C)C)c1O.
What is the InChIKey of 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol?
The InChIKey is YZDAHKBHIGEAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N4O/c1-9(2)13-6-11(7-14(10(3)4)15(13)22)5-12-8-20-17(19)21-16(12)18/h6-10,22H,5H2,1-4H3,(H4,18,19,20,21).
What are the key properties of 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol?
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol has a molecular weight of 300.41 g/mol, XLogP of 3.18, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-di(propan-2-yl)phenol is sourced from PubChem (CID 13112740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).