C17H24N4O — CID 13112756
5-[(4-ethoxy-3,5-diethylphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 13112756) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 5-[(4-ethoxy-3,5-diethylphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(4-ethoxy-3,5-diethylphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 13112756 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 5-[(4-ethoxy-3,5-diethylphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCOc1c(CC)cc(Cc2cnc(N)nc2N)cc1CC |
| InChI | InChI=1S/C17H24N4O/c1-4-12-7-11(8-13(5-2)15(12)22-6-3)9-14-10-20-17(19)21-16(14)18/h7-8,10H,4-6,9H2,1-3H3,(H4,18,19,20,21) |
| InChIKey | SQJSOPAMKIMPBC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |