C18H26N4O — CID 13112759
5-[(4-methoxy-3,5-dipropylphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 13112759) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 5-[(4-methoxy-3,5-dipropylphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-[(4-methoxy-3,5-dipropylphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 13112759 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 5-[(4-methoxy-3,5-dipropylphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCCc1cc(Cc2cnc(N)nc2N)cc(CCC)c1OC |
| InChI | InChI=1S/C18H26N4O/c1-4-6-13-8-12(9-14(7-5-2)16(13)23-3)10-15-11-21-18(20)22-17(15)19/h8-9,11H,4-7,10H2,1-3H3,(H4,19,20,21,22) |
| InChIKey | MDBNODWEXWKOIX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |