About (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine
(4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 131128665) has the molecular formula C9H10BrNO2S
and a molecular weight of 276.15 g/mol. Its IUPAC name is (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
Molecular Properties
| Compound Name | (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| PubChem CID | 131128665 |
| Molecular Formula | C9H10BrNO2S |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | N[C@H]1CCS(=O)(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C9H10BrNO2S/c10-6-1-2-7-8(11)3-4-14(12,13)9(7)5-6/h1-2,5,8H,3-4,11H2/t8-/m0/s1 |
| InChIKey | UGIVFORVNIDTSP-QMMMGPOBSA-N |
| XLogP | 1.63 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The IUPAC name of (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine (CID 131128665) is (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine.
What is the SMILES notation for (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The canonical SMILES for (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine is N[C@H]1CCS(=O)(=O)c2cc(Br)ccc21.
What is the InChIKey of (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
The InChIKey is UGIVFORVNIDTSP-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H10BrNO2S/c10-6-1-2-7-8(11)3-4-14(12,13)9(7)5-6/h1-2,5,8H,3-4,11H2/t8-/m0/s1.
What are the key properties of (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine?
(4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine has a molecular weight of 276.15 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-7-bromo-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine is sourced from PubChem (CID 131128665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).