About N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide
N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide (PubChem CID 131129299) has the molecular formula C6H7FN2OS
and a molecular weight of 174.20 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 131129299 |
| Molecular Formula | C6H7FN2OS |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NCCF)c1nccs1 |
| InChI | InChI=1S/C6H7FN2OS/c7-1-2-8-5(10)6-9-3-4-11-6/h3-4H,1-2H2,(H,8,10) |
| InChIKey | GRLWPVGGQHRTDW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide?
The IUPAC name of N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide (CID 131129299) is N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide is O=C(NCCF)c1nccs1.
What is the InChIKey of N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide?
The InChIKey is GRLWPVGGQHRTDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2OS/c7-1-2-8-5(10)6-9-3-4-11-6/h3-4H,1-2H2,(H,8,10).
What are the key properties of N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide?
N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide has a molecular weight of 174.20 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 131129299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).