About 6-chloro-N,2,3-trimethylaniline
6-chloro-N,2,3-trimethylaniline (PubChem CID 131129366) has the molecular formula C9H12ClN
and a molecular weight of 169.65 g/mol. Its IUPAC name is 6-chloro-N,2,3-trimethylaniline.
Molecular Properties
| Compound Name | 6-chloro-N,2,3-trimethylaniline |
| PubChem CID | 131129366 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.65 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 6-chloro-N,2,3-trimethylaniline |
| SMILES | CNc1c(Cl)ccc(C)c1C |
| InChI | InChI=1S/C9H12ClN/c1-6-4-5-8(10)9(11-3)7(6)2/h4-5,11H,1-3H3 |
| InChIKey | PRHCJECMIURRBD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.65 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-N,2,3-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N,2,3-trimethylaniline?
The IUPAC name of 6-chloro-N,2,3-trimethylaniline (CID 131129366) is 6-chloro-N,2,3-trimethylaniline.
What is the SMILES notation for 6-chloro-N,2,3-trimethylaniline?
The canonical SMILES for 6-chloro-N,2,3-trimethylaniline is CNc1c(Cl)ccc(C)c1C.
What is the InChIKey of 6-chloro-N,2,3-trimethylaniline?
The InChIKey is PRHCJECMIURRBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN/c1-6-4-5-8(10)9(11-3)7(6)2/h4-5,11H,1-3H3.
What are the key properties of 6-chloro-N,2,3-trimethylaniline?
6-chloro-N,2,3-trimethylaniline has a molecular weight of 169.65 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N,2,3-trimethylaniline is sourced from PubChem (CID 131129366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).