About N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide
N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide (PubChem CID 131131449) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide.
Molecular Properties
| Compound Name | N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide |
| PubChem CID | 131131449 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide |
| SMILES | CC[C@@H]1C[C@H]1NC(=O)C(C)(C)O |
| InChI | InChI=1S/C9H17NO2/c1-4-6-5-7(6)10-8(11)9(2,3)12/h6-7,12H,4-5H2,1-3H3,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | NPQUISOHYCHAKD-RNFRBKRXSA-N |
| XLogP | 0.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide?
The IUPAC name of N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide (CID 131131449) is N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide.
What is the SMILES notation for N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide?
The canonical SMILES for N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide is CC[C@@H]1C[C@H]1NC(=O)C(C)(C)O.
What is the InChIKey of N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide?
The InChIKey is NPQUISOHYCHAKD-RNFRBKRXSA-N. The full InChI is InChI=1S/C9H17NO2/c1-4-6-5-7(6)10-8(11)9(2,3)12/h6-7,12H,4-5H2,1-3H3,(H,10,11)/t6-,7-/m1/s1.
What are the key properties of N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide?
N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide has a molecular weight of 171.24 g/mol, XLogP of 0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2R)-2-ethylcyclopropyl]-2-hydroxy-2-methylpropanamide is sourced from PubChem (CID 131131449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).