About 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine
3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine (PubChem CID 131131886) has the molecular formula C9H17FN2
and a molecular weight of 172.25 g/mol. Its IUPAC name is 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine |
| PubChem CID | 131131886 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine |
| SMILES | CC1CN(C)CC1N1CC(F)C1 |
| InChI | InChI=1S/C9H17FN2/c1-7-3-11(2)6-9(7)12-4-8(10)5-12/h7-9H,3-6H2,1-2H3 |
| InChIKey | ROGFSDWYFIBILC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine?
The IUPAC name of 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine (CID 131131886) is 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine.
What is the SMILES notation for 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine?
The canonical SMILES for 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine is CC1CN(C)CC1N1CC(F)C1.
What is the InChIKey of 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine?
The InChIKey is ROGFSDWYFIBILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17FN2/c1-7-3-11(2)6-9(7)12-4-8(10)5-12/h7-9H,3-6H2,1-2H3.
What are the key properties of 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine?
3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine has a molecular weight of 172.25 g/mol, XLogP of 0.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine is sourced from PubChem (CID 131131886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).