C9H17FN2 — CID 131131886
3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine (PubChem CID 131131886) has the molecular formula C9H17FN2 and a molecular weight of 172.25 g/mol. Its IUPAC name is 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine.
| Compound Name | 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 131131886 |
| Molecular Formula | C9H17FN2 |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.14 |
| IUPAC Name | 3-(3-fluoroazetidin-1-yl)-1,4-dimethylpyrrolidine |
| SMILES | CC1CN(C)CC1N1CC(F)C1 |
| InChI | InChI=1S/C9H17FN2/c1-7-3-11(2)6-9(7)12-4-8(10)5-12/h7-9H,3-6H2,1-2H3 |
| InChIKey | ROGFSDWYFIBILC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |