About 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane
2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane (PubChem CID 131132191) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane.
Molecular Properties
| Compound Name | 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane |
| PubChem CID | 131132191 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane |
| SMILES | CC1CN(c2nccs2)CCCO1 |
| InChI | InChI=1S/C9H14N2OS/c1-8-7-11(4-2-5-12-8)9-10-3-6-13-9/h3,6,8H,2,4-5,7H2,1H3 |
| InChIKey | LIVCLPZGWSASQE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane?
The IUPAC name of 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane (CID 131132191) is 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane.
What is the SMILES notation for 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane?
The canonical SMILES for 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane is CC1CN(c2nccs2)CCCO1.
What is the InChIKey of 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane?
The InChIKey is LIVCLPZGWSASQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-8-7-11(4-2-5-12-8)9-10-3-6-13-9/h3,6,8H,2,4-5,7H2,1H3.
What are the key properties of 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane?
2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane has a molecular weight of 198.29 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(1,3-thiazol-2-yl)-1,4-oxazepane is sourced from PubChem (CID 131132191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).