About 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane
9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane (PubChem CID 13113306) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 13113306 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC1CCC(C(C)C)C2(C1)OCCO2 |
| InChI | InChI=1S/C12H22O2/c1-9(2)11-5-4-10(3)8-12(11)13-6-7-14-12/h9-11H,4-8H2,1-3H3 |
| InChIKey | VSRLYSJKKXAFCR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane (CID 13113306) is 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane is CC1CCC(C(C)C)C2(C1)OCCO2.
What is the InChIKey of 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane?
The InChIKey is VSRLYSJKKXAFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-9(2)11-5-4-10(3)8-12(11)13-6-7-14-12/h9-11H,4-8H2,1-3H3.
What are the key properties of 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane?
9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane has a molecular weight of 198.31 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6-propan-2-yl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 13113306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).