C21H17FN4O2S — CID 1311336
(7Z)-7-(1,5-dimethyl-2-oxoindol-3-ylidene)-3-(4-fluorophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one (PubChem CID 1311336) has the molecular formula C21H17FN4O2S and a molecular weight of 408.46 g/mol. Its IUPAC name is (7Z)-7-(1,5-dimethyl-2-oxoindol-3-ylidene)-3-(4-fluorophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one.
| Compound Name | (7Z)-7-(1,5-dimethyl-2-oxoindol-3-ylidene)-3-(4-fluorophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 1311336 |
| Molecular Formula | C21H17FN4O2S |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (7Z)-7-(1,5-dimethyl-2-oxoindol-3-ylidene)-3-(4-fluorophenyl)-2,4-dihydro-[1,3]thiazolo[3,2-a][1,3,5]triazin-6-one |
| SMILES | Cc1ccc2c(c1)/C(=c1/sc3n(c1=O)CN(c1ccc(F)cc1)CN=3)C(=O)N2C |
| InChI | InChI=1S/C21H17FN4O2S/c1-12-3-8-16-15(9-12)17(19(27)24(16)2)18-20(28)26-11-25(10-23-21(26)29-18)14-6-4-13(22)5-7-14/h3-9H,10-11H2,1-2H3/b18-17- |
| InChIKey | LJRGQEQPICEFOA-ZCXUNETKSA-N |
| XLogP | 1.59 |
| TPSA | 57.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |