About [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol
[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol (PubChem CID 131133777) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol |
| PubChem CID | 131133777 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol |
| SMILES | Cc1cnc(NCC2(CO)CC2)s1 |
| InChI | InChI=1S/C9H14N2OS/c1-7-4-10-8(13-7)11-5-9(6-12)2-3-9/h4,12H,2-3,5-6H2,1H3,(H,10,11) |
| InChIKey | HRBDOEYNKPPEDU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol?
The IUPAC name of [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol (CID 131133777) is [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol.
What is the SMILES notation for [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol?
The canonical SMILES for [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol is Cc1cnc(NCC2(CO)CC2)s1.
What is the InChIKey of [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol?
The InChIKey is HRBDOEYNKPPEDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2OS/c1-7-4-10-8(13-7)11-5-9(6-12)2-3-9/h4,12H,2-3,5-6H2,1H3,(H,10,11).
What are the key properties of [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol?
[1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol has a molecular weight of 198.29 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[(5-methyl-1,3-thiazol-2-yl)amino]methyl]cyclopropyl]methanol is sourced from PubChem (CID 131133777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).