C8H15NO2 — CID 131134003
N-(2-hydroxyethyl)-3-methylcyclobutane-1-carboxamide (PubChem CID 131134003) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-3-methylcyclobutane-1-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-3-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 131134003 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N-(2-hydroxyethyl)-3-methylcyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)NCCO)C1 |
| InChI | InChI=1S/C8H15NO2/c1-6-4-7(5-6)8(11)9-2-3-10/h6-7,10H,2-5H2,1H3,(H,9,11) |
| InChIKey | WQBRKTZGXRVJJC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |