C10H21N3O — CID 131134166
2-amino-N-(1-piperidin-3-ylethyl)propanamide (PubChem CID 131134166) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-amino-N-(1-piperidin-3-ylethyl)propanamide.
| Compound Name | 2-amino-N-(1-piperidin-3-ylethyl)propanamide |
|---|---|
| PubChem CID | 131134166 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 2-amino-N-(1-piperidin-3-ylethyl)propanamide |
| SMILES | CC(N)C(=O)NC(C)C1CCCNC1 |
| InChI | InChI=1S/C10H21N3O/c1-7(11)10(14)13-8(2)9-4-3-5-12-6-9/h7-9,12H,3-6,11H2,1-2H3,(H,13,14) |
| InChIKey | YYGSOJGZZTZFQX-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |