C9H13NO4 — CID 131134204
3-[(2,2-dimethylcyclobutyl)amino]-2,3-dioxopropanoic acid (PubChem CID 131134204) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-[(2,2-dimethylcyclobutyl)amino]-2,3-dioxopropanoic acid.
| Compound Name | 3-[(2,2-dimethylcyclobutyl)amino]-2,3-dioxopropanoic acid |
|---|---|
| PubChem CID | 131134204 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-[(2,2-dimethylcyclobutyl)amino]-2,3-dioxopropanoic acid |
| SMILES | CC1(C)CCC1NC(=O)C(=O)C(=O)O |
| InChI | InChI=1S/C9H13NO4/c1-9(2)4-3-5(9)10-7(12)6(11)8(13)14/h5H,3-4H2,1-2H3,(H,10,12)(H,13,14) |
| InChIKey | PZBIZEKXCGTTCO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|