C11H23ClN2O — CID 131134215
N-[(2S)-1-aminopropan-2-yl]-3-methylcyclohexane-1-carboxamide;hydrochloride (PubChem CID 131134215) has the molecular formula C11H23ClN2O and a molecular weight of 234.77 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-3-methylcyclohexane-1-carboxamide;hydrochloride.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-3-methylcyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 131134215 |
| Molecular Formula | C11H23ClN2O |
| Molecular Weight | 234.77 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-3-methylcyclohexane-1-carboxamide;hydrochloride |
| SMILES | CC1CCCC(C(=O)N[C@@H](C)CN)C1.Cl |
| InChI | InChI=1S/C11H22N2O.ClH/c1-8-4-3-5-10(6-8)11(14)13-9(2)7-12;/h8-10H,3-7,12H2,1-2H3,(H,13,14);1H/t8?,9-,10?;/m0./s1 |
| InChIKey | RANWLMXUPDMCGL-WUWPOBJPSA-N |
| XLogP | 1.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.77 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |