About 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol
3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol (PubChem CID 131134349) has the molecular formula C8H13NOS
and a molecular weight of 171.26 g/mol. Its IUPAC name is 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol.
Molecular Properties
| Compound Name | 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol |
| PubChem CID | 131134349 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol |
| SMILES | Cc1cc(C(C)C(C)O)sn1 |
| InChI | InChI=1S/C8H13NOS/c1-5-4-8(11-9-5)6(2)7(3)10/h4,6-7,10H,1-3H3 |
| InChIKey | FXYNNRNSSYEIDQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol?
The IUPAC name of 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol (CID 131134349) is 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol.
What is the SMILES notation for 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol?
The canonical SMILES for 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol is Cc1cc(C(C)C(C)O)sn1.
What is the InChIKey of 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol?
The InChIKey is FXYNNRNSSYEIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NOS/c1-5-4-8(11-9-5)6(2)7(3)10/h4,6-7,10H,1-3H3.
What are the key properties of 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol?
3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol has a molecular weight of 171.26 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-1,2-thiazol-5-yl)butan-2-ol is sourced from PubChem (CID 131134349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).