About 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile
2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile (PubChem CID 131134565) has the molecular formula C6H8N4S
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile.
Molecular Properties
| Compound Name | 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile |
| PubChem CID | 131134565 |
| Molecular Formula | C6H8N4S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile |
| SMILES | CCc1nsc(NCC#N)n1 |
| InChI | InChI=1S/C6H8N4S/c1-2-5-9-6(11-10-5)8-4-3-7/h2,4H2,1H3,(H,8,9,10) |
| InChIKey | RPOBCPLEVYXFQK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile?
The IUPAC name of 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile (CID 131134565) is 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile.
What is the SMILES notation for 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile?
The canonical SMILES for 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile is CCc1nsc(NCC#N)n1.
What is the InChIKey of 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile?
The InChIKey is RPOBCPLEVYXFQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4S/c1-2-5-9-6(11-10-5)8-4-3-7/h2,4H2,1H3,(H,8,9,10).
What are the key properties of 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile?
2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile has a molecular weight of 168.22 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-ethyl-1,2,4-thiadiazol-5-yl)amino]acetonitrile is sourced from PubChem (CID 131134565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).