About 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine
1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine (PubChem CID 131135114) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine.
Molecular Properties
| Compound Name | 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine |
| PubChem CID | 131135114 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine |
| SMILES | CCCn1c(N)nc2c1CCOC2 |
| InChI | InChI=1S/C9H15N3O/c1-2-4-12-8-3-5-13-6-7(8)11-9(12)10/h2-6H2,1H3,(H2,10,11) |
| InChIKey | KIJUVFXYFIUKHM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine?
The IUPAC name of 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine (CID 131135114) is 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine.
What is the SMILES notation for 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine?
The canonical SMILES for 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine is CCCn1c(N)nc2c1CCOC2.
What is the InChIKey of 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine?
The InChIKey is KIJUVFXYFIUKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-2-4-12-8-3-5-13-6-7(8)11-9(12)10/h2-6H2,1H3,(H2,10,11).
What are the key properties of 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine?
1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine has a molecular weight of 181.24 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-6,7-dihydro-4H-pyrano[3,4-d]imidazol-2-amine is sourced from PubChem (CID 131135114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).