About (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene
(2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene (PubChem CID 13113516) has the molecular formula C11H17BrO
and a molecular weight of 245.16 g/mol. Its IUPAC name is (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene.
Molecular Properties
| Compound Name | (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene |
| PubChem CID | 13113516 |
| Molecular Formula | C11H17BrO |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene |
| SMILES | C=C(Br)CCCOC/C=C/C=C/C |
| InChI | InChI=1S/C11H17BrO/c1-3-4-5-6-9-13-10-7-8-11(2)12/h3-6H,2,7-10H2,1H3/b4-3+,6-5+ |
| InChIKey | GXWDLYWAIHOZSY-VNKDHWASSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene?
The IUPAC name of (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene (CID 13113516) is (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene.
What is the SMILES notation for (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene?
The canonical SMILES for (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene is C=C(Br)CCCOC/C=C/C=C/C.
What is the InChIKey of (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene?
The InChIKey is GXWDLYWAIHOZSY-VNKDHWASSA-N. The full InChI is InChI=1S/C11H17BrO/c1-3-4-5-6-9-13-10-7-8-11(2)12/h3-6H,2,7-10H2,1H3/b4-3+,6-5+.
What are the key properties of (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene?
(2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene has a molecular weight of 245.16 g/mol, XLogP of 3.82, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene is sourced from PubChem (CID 13113516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).