C11H17BrO — CID 13113516
(2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene (PubChem CID 13113516) has the molecular formula C11H17BrO and a molecular weight of 245.16 g/mol. Its IUPAC name is (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene.
| Compound Name | (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene |
|---|---|
| PubChem CID | 13113516 |
| Molecular Formula | C11H17BrO |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (2E,4E)-1-(4-bromopent-4-enoxy)hexa-2,4-diene |
| SMILES | C=C(Br)CCCOC/C=C/C=C/C |
| InChI | InChI=1S/C11H17BrO/c1-3-4-5-6-9-13-10-7-8-11(2)12/h3-6H,2,7-10H2,1H3/b4-3+,6-5+ |
| InChIKey | GXWDLYWAIHOZSY-VNKDHWASSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|