C9H13N3OS — CID 131135373
[(1R,4S)-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]cyclopent-2-en-1-yl]methanol (PubChem CID 131135373) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is [(1R,4S)-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 131135373 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | [(1R,4S)-4-[(3-methyl-1,2,4-thiadiazol-5-yl)amino]cyclopent-2-en-1-yl]methanol |
| SMILES | Cc1nsc(N[C@@H]2C=C[C@H](CO)C2)n1 |
| InChI | InChI=1S/C9H13N3OS/c1-6-10-9(14-12-6)11-8-3-2-7(4-8)5-13/h2-3,7-8,13H,4-5H2,1H3,(H,10,11,12)/t7-,8+/m0/s1 |
| InChIKey | MFSOKNMWJRUJGK-JGVFFNPUSA-N |
| XLogP | 1.20 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|