About 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole
3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole (PubChem CID 13113654) has the molecular formula C13H11NOS
and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole.
Molecular Properties
| Compound Name | 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole |
| PubChem CID | 13113654 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole |
| SMILES | Cc1cc(C)c(-c2onc3ccccc23)s1 |
| InChI | InChI=1S/C13H11NOS/c1-8-7-9(2)16-13(8)12-10-5-3-4-6-11(10)14-15-12/h3-7H,1-2H3 |
| InChIKey | VDZYDXZJXBBCRC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole?
The IUPAC name of 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole (CID 13113654) is 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole.
What is the SMILES notation for 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole?
The canonical SMILES for 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole is Cc1cc(C)c(-c2onc3ccccc23)s1.
What is the InChIKey of 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole?
The InChIKey is VDZYDXZJXBBCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NOS/c1-8-7-9(2)16-13(8)12-10-5-3-4-6-11(10)14-15-12/h3-7H,1-2H3.
What are the key properties of 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole?
3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole has a molecular weight of 229.30 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylthiophen-2-yl)-2,1-benzoxazole is sourced from PubChem (CID 13113654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).