About 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane
3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane (PubChem CID 131136747) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane.
Molecular Properties
| Compound Name | 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane |
| PubChem CID | 131136747 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane |
| SMILES | CC(C)(C)CN1CC2CCCC(C1)N2 |
| InChI | InChI=1S/C12H24N2/c1-12(2,3)9-14-7-10-5-4-6-11(8-14)13-10/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | NKEAMYXBGXPNIK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane?
The IUPAC name of 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane (CID 131136747) is 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane.
What is the SMILES notation for 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane?
The canonical SMILES for 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane is CC(C)(C)CN1CC2CCCC(C1)N2.
What is the InChIKey of 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane?
The InChIKey is NKEAMYXBGXPNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-12(2,3)9-14-7-10-5-4-6-11(8-14)13-10/h10-11,13H,4-9H2,1-3H3.
What are the key properties of 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane?
3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane has a molecular weight of 196.34 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylpropyl)-3,9-diazabicyclo[3.3.1]nonane is sourced from PubChem (CID 131136747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).