About 2-(1-adamantyl)propanoic acid
2-(1-adamantyl)propanoic acid (PubChem CID 13113723) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(1-adamantyl)propanoic acid.
Molecular Properties
| Compound Name | 2-(1-adamantyl)propanoic acid |
| PubChem CID | 13113723 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-(1-adamantyl)propanoic acid |
| SMILES | CC(C(=O)O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H20O2/c1-8(12(14)15)13-5-9-2-10(6-13)4-11(3-9)7-13/h8-11H,2-7H2,1H3,(H,14,15) |
| InChIKey | JJOIGVWVISBUAZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1-adamantyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)propanoic acid?
The IUPAC name of 2-(1-adamantyl)propanoic acid (CID 13113723) is 2-(1-adamantyl)propanoic acid.
What is the SMILES notation for 2-(1-adamantyl)propanoic acid?
The canonical SMILES for 2-(1-adamantyl)propanoic acid is CC(C(=O)O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 2-(1-adamantyl)propanoic acid?
The InChIKey is JJOIGVWVISBUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-8(12(14)15)13-5-9-2-10(6-13)4-11(3-9)7-13/h8-11H,2-7H2,1H3,(H,14,15).
What are the key properties of 2-(1-adamantyl)propanoic acid?
2-(1-adamantyl)propanoic acid has a molecular weight of 208.30 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)propanoic acid is sourced from PubChem (CID 13113723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).