C5H3F5N4O — CID 131137580
2,2,3,3,3-pentafluoro-1-(2-methyltetrazol-5-yl)propan-1-one (PubChem CID 131137580) has the molecular formula C5H3F5N4O and a molecular weight of 230.10 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(2-methyltetrazol-5-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(2-methyltetrazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 131137580 |
| Molecular Formula | C5H3F5N4O |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(2-methyltetrazol-5-yl)propan-1-one |
| SMILES | Cn1nnc(C(=O)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C5H3F5N4O/c1-14-12-3(11-13-14)2(15)4(6,7)5(8,9)10/h1H3 |
| InChIKey | SLIVKFRUEMJFOL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|