C11H12O2 — CID 131137723
(3aR,6aR)-1-prop-2-ynyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione (PubChem CID 131137723) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (3aR,6aR)-1-prop-2-ynyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione.
| Compound Name | (3aR,6aR)-1-prop-2-ynyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
|---|---|
| PubChem CID | 131137723 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (3aR,6aR)-1-prop-2-ynyl-1,3,3a,4,6,6a-hexahydropentalene-2,5-dione |
| SMILES | C#CCC1C(=O)C[C@H]2CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C11H12O2/c1-2-3-9-10-6-8(12)4-7(10)5-11(9)13/h1,7,9-10H,3-6H2/t7-,9?,10-/m1/s1 |
| InChIKey | KUWAXMWPMBRHLM-DJROOOTPSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|