About 2-bromo-6,7-diiodo-1-benzothiophene
2-bromo-6,7-diiodo-1-benzothiophene (PubChem CID 131138066) has the molecular formula C8H3BrI2S
and a molecular weight of 464.89 g/mol. Its IUPAC name is 2-bromo-6,7-diiodo-1-benzothiophene.
Molecular Properties
| Compound Name | 2-bromo-6,7-diiodo-1-benzothiophene |
| PubChem CID | 131138066 |
| Molecular Formula | C8H3BrI2S |
| Molecular Weight | 464.89 g/mol |
| Exact Mass | 463.72 |
| IUPAC Name | 2-bromo-6,7-diiodo-1-benzothiophene |
| SMILES | Brc1cc2ccc(I)c(I)c2s1 |
| InChI | InChI=1S/C8H3BrI2S/c9-6-3-4-1-2-5(10)7(11)8(4)12-6/h1-3H |
| InChIKey | QNOCNNYEKUVGEN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.89 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6,7-diiodo-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6,7-diiodo-1-benzothiophene?
The IUPAC name of 2-bromo-6,7-diiodo-1-benzothiophene (CID 131138066) is 2-bromo-6,7-diiodo-1-benzothiophene.
What is the SMILES notation for 2-bromo-6,7-diiodo-1-benzothiophene?
The canonical SMILES for 2-bromo-6,7-diiodo-1-benzothiophene is Brc1cc2ccc(I)c(I)c2s1.
What is the InChIKey of 2-bromo-6,7-diiodo-1-benzothiophene?
The InChIKey is QNOCNNYEKUVGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrI2S/c9-6-3-4-1-2-5(10)7(11)8(4)12-6/h1-3H.
What are the key properties of 2-bromo-6,7-diiodo-1-benzothiophene?
2-bromo-6,7-diiodo-1-benzothiophene has a molecular weight of 464.89 g/mol, XLogP of 4.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6,7-diiodo-1-benzothiophene is sourced from PubChem (CID 131138066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).