About 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate
1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate (PubChem CID 13113850) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate.
Molecular Properties
| Compound Name | 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate |
| PubChem CID | 13113850 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate |
| SMILES | CC(=O)OC12C=CC(=CC1)CCCCCC2 |
| InChI | InChI=1S/C14H20O2/c1-12(15)16-14-9-5-3-2-4-6-13(7-10-14)8-11-14/h7-8,10H,2-6,9,11H2,1H3 |
| InChIKey | NOKUBVCIICSFGR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate?
The IUPAC name of 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate (CID 13113850) is 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate.
What is the SMILES notation for 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate?
The canonical SMILES for 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate is CC(=O)OC12C=CC(=CC1)CCCCCC2.
What is the InChIKey of 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate?
The InChIKey is NOKUBVCIICSFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O2/c1-12(15)16-14-9-5-3-2-4-6-13(7-10-14)8-11-14/h7-8,10H,2-6,9,11H2,1H3.
What are the key properties of 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate?
1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate has a molecular weight of 220.31 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bicyclo[6.2.2]dodeca-8(12),9-dienyl acetate is sourced from PubChem (CID 13113850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).