About 3-methylidenespiro[5.5]undeca-1,4-diene
3-methylidenespiro[5.5]undeca-1,4-diene (PubChem CID 13113851) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-methylidenespiro[5.5]undeca-1,4-diene.
Molecular Properties
| Compound Name | 3-methylidenespiro[5.5]undeca-1,4-diene |
| PubChem CID | 13113851 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 3-methylidenespiro[5.5]undeca-1,4-diene |
| SMILES | C=C1C=CC2(C=C1)CCCCC2 |
| InChI | InChI=1S/C12H16/c1-11-5-9-12(10-6-11)7-3-2-4-8-12/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | ILMNTBYTGXQWEJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methylidenespiro[5.5]undeca-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenespiro[5.5]undeca-1,4-diene?
The IUPAC name of 3-methylidenespiro[5.5]undeca-1,4-diene (CID 13113851) is 3-methylidenespiro[5.5]undeca-1,4-diene.
What is the SMILES notation for 3-methylidenespiro[5.5]undeca-1,4-diene?
The canonical SMILES for 3-methylidenespiro[5.5]undeca-1,4-diene is C=C1C=CC2(C=C1)CCCCC2.
What is the InChIKey of 3-methylidenespiro[5.5]undeca-1,4-diene?
The InChIKey is ILMNTBYTGXQWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-11-5-9-12(10-6-11)7-3-2-4-8-12/h5-6,9-10H,1-4,7-8H2.
What are the key properties of 3-methylidenespiro[5.5]undeca-1,4-diene?
3-methylidenespiro[5.5]undeca-1,4-diene has a molecular weight of 160.26 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenespiro[5.5]undeca-1,4-diene is sourced from PubChem (CID 13113851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).