About 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one
2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 131139094) has the molecular formula C6H6N4O3
and a molecular weight of 182.14 g/mol. Its IUPAC name is 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one.
Molecular Properties
| Compound Name | 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| PubChem CID | 131139094 |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | O=C1NCCn2nc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C6H6N4O3/c11-6-4-3-5(10(12)13)8-9(4)2-1-7-6/h3H,1-2H2,(H,7,11) |
| InChIKey | NEJZJOKZLKDUAD-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one?
The IUPAC name of 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (CID 131139094) is 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one.
What is the SMILES notation for 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one?
The canonical SMILES for 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one is O=C1NCCn2nc([N+](=O)[O-])cc21.
What is the InChIKey of 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one?
The InChIKey is NEJZJOKZLKDUAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O3/c11-6-4-3-5(10(12)13)8-9(4)2-1-7-6/h3H,1-2H2,(H,7,11).
What are the key properties of 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one?
2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one has a molecular weight of 182.14 g/mol, XLogP of -0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one is sourced from PubChem (CID 131139094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).