C12H12O8 — CID 13113952
5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 13113952) has the molecular formula C12H12O8 and a molecular weight of 284.22 g/mol. Its IUPAC name is 5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 13113952 |
| Molecular Formula | C12H12O8 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=C2C(=O)OC(C)(C)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C12H12O8/c1-11(2)17-7(13)5(8(14)18-11)6-9(15)19-12(3,4)20-10(6)16/h1-4H3 |
| InChIKey | RWTKAAPVSCAIDT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|