C24H25NS2 — CID 13113995
2,4,6-tris(4-methylphenyl)-1,3,5-dithiazinane (PubChem CID 13113995) has the molecular formula C24H25NS2 and a molecular weight of 391.61 g/mol. Its IUPAC name is 2,4,6-tris(4-methylphenyl)-1,3,5-dithiazinane.
| Compound Name | 2,4,6-tris(4-methylphenyl)-1,3,5-dithiazinane |
|---|---|
| PubChem CID | 13113995 |
| Molecular Formula | C24H25NS2 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2,4,6-tris(4-methylphenyl)-1,3,5-dithiazinane |
| SMILES | Cc1ccc(C2NC(c3ccc(C)cc3)SC(c3ccc(C)cc3)S2)cc1 |
| InChI | InChI=1S/C24H25NS2/c1-16-4-10-19(11-5-16)22-25-23(20-12-6-17(2)7-13-20)27-24(26-22)21-14-8-18(3)9-15-21/h4-15,22-25H,1-3H3 |
| InChIKey | FBUZNSZLPCEYDE-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |