C9H15NO3S — CID 131140597
N-[(3R,4S)-4-hydroxyoxolan-3-yl]thiolane-3-carboxamide (PubChem CID 131140597) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is N-[(3R,4S)-4-hydroxyoxolan-3-yl]thiolane-3-carboxamide.
| Compound Name | N-[(3R,4S)-4-hydroxyoxolan-3-yl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 131140597 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | N-[(3R,4S)-4-hydroxyoxolan-3-yl]thiolane-3-carboxamide |
| SMILES | O=C(N[C@@H]1COC[C@H]1O)C1CCSC1 |
| InChI | InChI=1S/C9H15NO3S/c11-8-4-13-3-7(8)10-9(12)6-1-2-14-5-6/h6-8,11H,1-5H2,(H,10,12)/t6?,7-,8-/m1/s1 |
| InChIKey | PTQZSKZUYSTZTH-SPDVFEMOSA-N |
| XLogP | -0.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |