C7H11BrN4O2S — CID 131140623
2-[(5-bromo-2-methylpyrimidin-4-yl)amino]ethanesulfonamide (PubChem CID 131140623) has the molecular formula C7H11BrN4O2S and a molecular weight of 295.16 g/mol. Its IUPAC name is 2-[(5-bromo-2-methylpyrimidin-4-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(5-bromo-2-methylpyrimidin-4-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 131140623 |
| Molecular Formula | C7H11BrN4O2S |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 2-[(5-bromo-2-methylpyrimidin-4-yl)amino]ethanesulfonamide |
| SMILES | Cc1ncc(Br)c(NCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C7H11BrN4O2S/c1-5-11-4-6(8)7(12-5)10-2-3-15(9,13)14/h4H,2-3H2,1H3,(H2,9,13,14)(H,10,11,12) |
| InChIKey | ZPWZFNFZJNGZQM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |