C10H18N2O — CID 131140835
4-(2,5-dihydropyrrol-1-ylmethyl)-4-methyloxolan-3-amine (PubChem CID 131140835) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 4-(2,5-dihydropyrrol-1-ylmethyl)-4-methyloxolan-3-amine.
| Compound Name | 4-(2,5-dihydropyrrol-1-ylmethyl)-4-methyloxolan-3-amine |
|---|---|
| PubChem CID | 131140835 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 4-(2,5-dihydropyrrol-1-ylmethyl)-4-methyloxolan-3-amine |
| SMILES | CC1(CN2CC=CC2)COCC1N |
| InChI | InChI=1S/C10H18N2O/c1-10(8-13-6-9(10)11)7-12-4-2-3-5-12/h2-3,9H,4-8,11H2,1H3 |
| InChIKey | HRTGNCRAXSHHPJ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|