About 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile
2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile (PubChem CID 131140880) has the molecular formula C8H11FN2O2S
and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile.
Molecular Properties
| Compound Name | 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile |
| PubChem CID | 131140880 |
| Molecular Formula | C8H11FN2O2S |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile |
| SMILES | CC(C#N)S(=O)(=O)N1CCC=C(F)C1 |
| InChI | InChI=1S/C8H11FN2O2S/c1-7(5-10)14(12,13)11-4-2-3-8(9)6-11/h3,7H,2,4,6H2,1H3 |
| InChIKey | DSHPMPNFQIMSIE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile?
The IUPAC name of 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile (CID 131140880) is 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile.
What is the SMILES notation for 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile?
The canonical SMILES for 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile is CC(C#N)S(=O)(=O)N1CCC=C(F)C1.
What is the InChIKey of 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile?
The InChIKey is DSHPMPNFQIMSIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O2S/c1-7(5-10)14(12,13)11-4-2-3-8(9)6-11/h3,7H,2,4,6H2,1H3.
What are the key properties of 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile?
2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile has a molecular weight of 218.25 g/mol, XLogP of 0.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]propanenitrile is sourced from PubChem (CID 131140880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).