C10H18N2O4 — CID 13114146
diethyl 2-[(2,2-dimethylhydrazinyl)methylidene]propanedioate (PubChem CID 13114146) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is diethyl 2-[(2,2-dimethylhydrazinyl)methylidene]propanedioate.
| Compound Name | diethyl 2-[(2,2-dimethylhydrazinyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 13114146 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | diethyl 2-[(2,2-dimethylhydrazinyl)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNN(C)C)C(=O)OCC |
| InChI | InChI=1S/C10H18N2O4/c1-5-15-9(13)8(7-11-12(3)4)10(14)16-6-2/h7,11H,5-6H2,1-4H3 |
| InChIKey | UWMBMQKVBUJBNZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|