About 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde
5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde (PubChem CID 131142453) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde |
| PubChem CID | 131142453 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde |
| SMILES | CO[C@@H]1CN(c2ccc(C=O)o2)C[C@H]1O |
| InChI | InChI=1S/C10H13NO4/c1-14-9-5-11(4-8(9)13)10-3-2-7(6-12)15-10/h2-3,6,8-9,13H,4-5H2,1H3/t8-,9-/m1/s1 |
| InChIKey | NWVGZCSFXMQQFO-RKDXNWHRSA-N |
| XLogP | 0.29 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde?
The IUPAC name of 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde (CID 131142453) is 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde.
What is the SMILES notation for 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde?
The canonical SMILES for 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde is CO[C@@H]1CN(c2ccc(C=O)o2)C[C@H]1O.
What is the InChIKey of 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde?
The InChIKey is NWVGZCSFXMQQFO-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H13NO4/c1-14-9-5-11(4-8(9)13)10-3-2-7(6-12)15-10/h2-3,6,8-9,13H,4-5H2,1H3/t8-,9-/m1/s1.
What are the key properties of 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde?
5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde has a molecular weight of 211.22 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]furan-2-carbaldehyde is sourced from PubChem (CID 131142453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).