About 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine
4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine (PubChem CID 13114263) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine |
| PubChem CID | 13114263 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine |
| SMILES | COc1cc(C)nc2c(C)nc(C)n12 |
| InChI | InChI=1S/C10H13N3O/c1-6-5-9(14-4)13-8(3)12-7(2)10(13)11-6/h5H,1-4H3 |
| InChIKey | ACIQXMDZXKICDX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine?
The IUPAC name of 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine (CID 13114263) is 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine.
What is the SMILES notation for 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine?
The canonical SMILES for 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine is COc1cc(C)nc2c(C)nc(C)n12.
What is the InChIKey of 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine?
The InChIKey is ACIQXMDZXKICDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-6-5-9(14-4)13-8(3)12-7(2)10(13)11-6/h5H,1-4H3.
What are the key properties of 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine?
4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine has a molecular weight of 191.23 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,6,8-trimethylimidazo[1,5-a]pyrimidine is sourced from PubChem (CID 13114263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).