About pyrimido[1,2-a]pyrimidin-2-one
pyrimido[1,2-a]pyrimidin-2-one (PubChem CID 13114303) has the molecular formula C7H5N3O
and a molecular weight of 147.14 g/mol. Its IUPAC name is pyrimido[1,2-a]pyrimidin-2-one.
Molecular Properties
| Compound Name | pyrimido[1,2-a]pyrimidin-2-one |
| PubChem CID | 13114303 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | pyrimido[1,2-a]pyrimidin-2-one |
| SMILES | O=c1ccn2cccnc2n1 |
| InChI | InChI=1S/C7H5N3O/c11-6-2-5-10-4-1-3-8-7(10)9-6/h1-5H |
| InChIKey | DGDZFKPPKUMSNR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrimido[1,2-a]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[1,2-a]pyrimidin-2-one?
The IUPAC name of pyrimido[1,2-a]pyrimidin-2-one (CID 13114303) is pyrimido[1,2-a]pyrimidin-2-one.
What is the SMILES notation for pyrimido[1,2-a]pyrimidin-2-one?
The canonical SMILES for pyrimido[1,2-a]pyrimidin-2-one is O=c1ccn2cccnc2n1.
What is the InChIKey of pyrimido[1,2-a]pyrimidin-2-one?
The InChIKey is DGDZFKPPKUMSNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O/c11-6-2-5-10-4-1-3-8-7(10)9-6/h1-5H.
What are the key properties of pyrimido[1,2-a]pyrimidin-2-one?
pyrimido[1,2-a]pyrimidin-2-one has a molecular weight of 147.14 g/mol, XLogP of 0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[1,2-a]pyrimidin-2-one is sourced from PubChem (CID 13114303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).