About 4-bromo-6-iodo-2,3-dihydroisoindol-1-one
4-bromo-6-iodo-2,3-dihydroisoindol-1-one (PubChem CID 131143347) has the molecular formula C8H5BrINO
and a molecular weight of 337.94 g/mol. Its IUPAC name is 4-bromo-6-iodo-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 4-bromo-6-iodo-2,3-dihydroisoindol-1-one |
| PubChem CID | 131143347 |
| Molecular Formula | C8H5BrINO |
| Molecular Weight | 337.94 g/mol |
| Exact Mass | 336.86 |
| IUPAC Name | 4-bromo-6-iodo-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2c(Br)cc(I)cc21 |
| InChI | InChI=1S/C8H5BrINO/c9-7-2-4(10)1-5-6(7)3-11-8(5)12/h1-2H,3H2,(H,11,12) |
| InChIKey | YHJHJWLVCDESDN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.94 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6-iodo-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-iodo-2,3-dihydroisoindol-1-one?
The IUPAC name of 4-bromo-6-iodo-2,3-dihydroisoindol-1-one (CID 131143347) is 4-bromo-6-iodo-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 4-bromo-6-iodo-2,3-dihydroisoindol-1-one?
The canonical SMILES for 4-bromo-6-iodo-2,3-dihydroisoindol-1-one is O=C1NCc2c(Br)cc(I)cc21.
What is the InChIKey of 4-bromo-6-iodo-2,3-dihydroisoindol-1-one?
The InChIKey is YHJHJWLVCDESDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrINO/c9-7-2-4(10)1-5-6(7)3-11-8(5)12/h1-2H,3H2,(H,11,12).
What are the key properties of 4-bromo-6-iodo-2,3-dihydroisoindol-1-one?
4-bromo-6-iodo-2,3-dihydroisoindol-1-one has a molecular weight of 337.94 g/mol, XLogP of 2.30, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-iodo-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 131143347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).